Problem- Ethyl butyrate, CH3 CH2 CH2 CH2 CH2 CH3 is an artifical fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH@CO2H(1)+CH2CH3OH(1) -> CH3CH2CH2CO2CH2CH3(1) + H2o(1).

Part A Given 7.80 of butanoic acid and excess ethanol , how many grams of ethyl butrate would be synthesized , assuming a complete 100% yield?

Part B: A chemist ran the reaction and obtained 5.15g of ethyl butyrate. What was the percent yield?

Explain the each step. Explain the process and each step.