Analysis of two unknown organic structures
Unknown compound A (C8H12) is reacted with H2 (excess) in the presence of a palladium catalyst forming compound B (C8H16). In addition when compound A is reacted with O3 followed by zinc and acetic acid the following two compounds are formed-
CH3-C(=O)-CH2-CH2-C(=O)-CH3 and HC(=O)-(O=)CH
Using the following data determine the structures of compound A and B.