A soft drink contains an unknown amount of citric acid, Ask an Expert

Academics

A soft drink contains an unknown amount of citric acid, C3H5O(COOH)3. 10.0ml of the soft drink requires 6.42 ml of 9.580 x 10^-2 M NaOH to reach the equivalance point in the following reaction. C3H50(COOH)3(aq) +3NaOH(aq)yields Na3C3H5O(COO)3(aq)+3H2O(l) What is the concentration of citric acid in the drink

View complete question

Chemistry, Academics

Category:- Chemistry
Reference No.:- M9863735

Have any Question?Write your Review or question?

Related Questions in Chemistry

Why do the instructions call for using a saturated solution

Why do the instructions call for using a saturated solution of NaOH rather than one at lower concentration? Why can we ignored in the calculation of the concentration of NaOH?

Determine the kinetic energy of a 750 kg mass moving at 613

Determine the kinetic energy of a 75.0 kg mass moving at 61.3 m/s. Your answer should be in Joules.

A sealed vessel contains a gaseous mixture of h2 and excess

A sealed vessel contains a gaseous mixture of H2 and excess O2. The mixture is at 500 K and has a total pressure of 140 kPa. After all of the hydrogen is reacted, the total pressure of the system measured at the same tem ...

The density of air at stp is 129gl if your stoppered

The density of air at STP is 1.29g/L. If your stoppered the250mL flask contains 242mL of water(also the volume of air it would contain), calculate the mass of air in the flask under STP.

The heat fusion of pure silicon is 434 kjmol how much

The heat fusion of pure silicon is 43.4 kJ/mol. How much energy would be needed to melt a 5.24 - g sample of silicon at its melting point of 1693 K?

Predict whether a precipitation reaction will occur in the

Predict whether a precipitation reaction will occur in the following situations. If a precipitation reaction occurs, enter the balanced chemical equation for the reaction. NiCl2(aq)+(NH4)2S(aq)→ AgNO3(aq)+CaBr2(aq)→

Calculate the volume in milliliters of a 0616m barium

Calculate the volume in milliliters of a 0.616M barium chlorate solution that contains 475.mmol of barium chlorate (Ba(ClO3)2). Round your answer to 3 significant digits.

Does dissolved solids such as sugar and salt modifychange

Does dissolved solids such as sugar and salt modify/change the boiling point of water; do mixtures have the same boiling point as pure substances?

A 200 ml sample of 0200 m hbr solution is titratedwith 0200

A 20.0 mL sample of 0.200 M HBr solution is titratedwith 0.200 M NaOH solution. Calculate the pH of the solution after the following volumes of base have been added. (19.8 mL)

What would be the effect on our body chemistry if large

What would be the effect on our body chemistry if large numbers of enzymes were to become malformed and how do they become malformed?

4,153,160 Questions Asked
13,132 Experts
2,558,936 Questions Answered

Ask Experts for help!!

Looking for Assignment Help?

Start excelling in your Courses, Get help with Assignment

Write us your full requirement for evaluation and you will receive response within 20 minutes turnaround time.

Ask Now Help with Problems, Get a Best Answer

Recent Questions

Ask Chemistry Expert